C28H19F4N3 — CID 67680008
2-[4-fluoro-3-(trifluoromethyl)phenyl]-1,1-dinaphthalen-1-ylguanidine (PubChem CID 67680008) has the molecular formula C28H19F4N3 and a molecular weight of 473.47 g/mol. Its IUPAC name is 2-[4-fluoro-3-(trifluoromethyl)phenyl]-1,1-dinaphthalen-1-ylguanidine.
| Compound Name | 2-[4-fluoro-3-(trifluoromethyl)phenyl]-1,1-dinaphthalen-1-ylguanidine |
|---|---|
| PubChem CID | 67680008 |
| Molecular Formula | C28H19F4N3 |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 2-[4-fluoro-3-(trifluoromethyl)phenyl]-1,1-dinaphthalen-1-ylguanidine |
| SMILES | N/C(=N\c1ccc(F)c(C(F)(F)F)c1)N(c1cccc2ccccc12)c1cccc2ccccc12 |
| InChI | InChI=1S/C28H19F4N3/c29-24-16-15-20(17-23(24)28(30,31)32)34-27(33)35(25-13-5-9-18-7-1-3-11-21(18)25)26-14-6-10-19-8-2-4-12-22(19)26/h1-17H,(H2,33,34) |
| InChIKey | BINKFBRFXNZYQT-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|