C17H29ClN6 — CID 162335340
(2S,6R)-N'-[N'-[4-(2-aminoethyl)phenyl]carbamimidoyl]-2,6-dimethylpiperidine-1-carboximidamide;hydrochloride (PubChem CID 162335340) has the molecular formula C17H29ClN6 and a molecular weight of 352.91 g/mol. Its IUPAC name is (2S,6R)-N'-[N'-[4-(2-aminoethyl)phenyl]carbamimidoyl]-2,6-dimethylpiperidine-1-carboximidamide;hydrochloride.
| Compound Name | (2S,6R)-N'-[N'-[4-(2-aminoethyl)phenyl]carbamimidoyl]-2,6-dimethylpiperidine-1-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 162335340 |
| Molecular Formula | C17H29ClN6 |
| Molecular Weight | 352.91 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | (2S,6R)-N'-[N'-[4-(2-aminoethyl)phenyl]carbamimidoyl]-2,6-dimethylpiperidine-1-carboximidamide;hydrochloride |
| SMILES | C[C@@H]1CCC[C@H](C)N1C(N)=N/C(N)=N/c1ccc(CCN)cc1.Cl |
| InChI | InChI=1S/C17H28N6.ClH/c1-12-4-3-5-13(2)23(12)17(20)22-16(19)21-15-8-6-14(7-9-15)10-11-18;/h6-9,12-13H,3-5,10-11,18H2,1-2H3,(H4,19,20,21,22);1H/t12-,13+; |
| InChIKey | LMUHWIRETFAWPN-OEEJBDNKSA-N |
| XLogP | 2.13 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.91 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|