C10H18Cl2N4O — CID 18621832
2-[4-(2-aminoethyl)phenyl]-1-methoxyguanidine;dihydrochloride (PubChem CID 18621832) has the molecular formula C10H18Cl2N4O and a molecular weight of 281.19 g/mol. Its IUPAC name is 2-[4-(2-aminoethyl)phenyl]-1-methoxyguanidine;dihydrochloride.
| Compound Name | 2-[4-(2-aminoethyl)phenyl]-1-methoxyguanidine;dihydrochloride |
|---|---|
| PubChem CID | 18621832 |
| Molecular Formula | C10H18Cl2N4O |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 2-[4-(2-aminoethyl)phenyl]-1-methoxyguanidine;dihydrochloride |
| SMILES | CON/C(N)=N/c1ccc(CCN)cc1.Cl.Cl |
| InChI | InChI=1S/C10H16N4O.2ClH/c1-15-14-10(12)13-9-4-2-8(3-5-9)6-7-11;;/h2-5H,6-7,11H2,1H3,(H3,12,13,14);2*1H |
| InChIKey | ABBPLMMKJNKJRZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|