C12H10F3N5O2 — CID 168601785
1-(diaminomethylidene)-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]guanidine (PubChem CID 168601785) has the molecular formula C12H10F3N5O2 and a molecular weight of 313.24 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]guanidine |
|---|---|
| PubChem CID | 168601785 |
| Molecular Formula | C12H10F3N5O2 |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 1-(diaminomethylidene)-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]guanidine |
| SMILES | NC(N)=N/C(N)=N/c1ccc2c(C(F)(F)F)cc(=O)oc2c1 |
| InChI | InChI=1S/C12H10F3N5O2/c13-12(14,15)7-4-9(21)22-8-3-5(1-2-6(7)8)19-11(18)20-10(16)17/h1-4H,(H6,16,17,18,19,20) |
| InChIKey | HVAQHHMLTRWJPR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 132.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|