About 3-amino-5-hydroxybenzoic acid;fluoromethane
3-amino-5-hydroxybenzoic acid;fluoromethane (PubChem CID 143667983) has the molecular formula C8H10FNO3
and a molecular weight of 187.17 g/mol. Its IUPAC name is 3-amino-5-hydroxybenzoic acid;fluoromethane.
Molecular Properties
| Compound Name | 3-amino-5-hydroxybenzoic acid;fluoromethane |
| PubChem CID | 143667983 |
| Molecular Formula | C8H10FNO3 |
| Molecular Weight | 187.17 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 3-amino-5-hydroxybenzoic acid;fluoromethane |
| SMILES | CF.Nc1cc(O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C7H7NO3.CH3F/c8-5-1-4(7(10)11)2-6(9)3-5;1-2/h1-3,9H,8H2,(H,10,11);1H3 |
| InChIKey | BQUWDHUAAAGNCS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.17 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-5-hydroxybenzoic acid;fluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-hydroxybenzoic acid;fluoromethane?
The IUPAC name of 3-amino-5-hydroxybenzoic acid;fluoromethane (CID 143667983) is 3-amino-5-hydroxybenzoic acid;fluoromethane.
What is the SMILES notation for 3-amino-5-hydroxybenzoic acid;fluoromethane?
The canonical SMILES for 3-amino-5-hydroxybenzoic acid;fluoromethane is CF.Nc1cc(O)cc(C(=O)O)c1.
What is the InChIKey of 3-amino-5-hydroxybenzoic acid;fluoromethane?
The InChIKey is BQUWDHUAAAGNCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3.CH3F/c8-5-1-4(7(10)11)2-6(9)3-5;1-2/h1-3,9H,8H2,(H,10,11);1H3.
What are the key properties of 3-amino-5-hydroxybenzoic acid;fluoromethane?
3-amino-5-hydroxybenzoic acid;fluoromethane has a molecular weight of 187.17 g/mol, XLogP of 1.26, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-hydroxybenzoic acid;fluoromethane is sourced from PubChem (CID 143667983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).