C17H17ClN2O — CID 169368563
2-chloro-N'-[4-(3,4-dimethylbenzoyl)phenyl]ethanimidamide (PubChem CID 169368563) has the molecular formula C17H17ClN2O and a molecular weight of 300.79 g/mol. Its IUPAC name is 2-chloro-N'-[4-(3,4-dimethylbenzoyl)phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[4-(3,4-dimethylbenzoyl)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169368563 |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2-chloro-N'-[4-(3,4-dimethylbenzoyl)phenyl]ethanimidamide |
| SMILES | Cc1ccc(C(=O)c2ccc(/N=C(/N)CCl)cc2)cc1C |
| InChI | InChI=1S/C17H17ClN2O/c1-11-3-4-14(9-12(11)2)17(21)13-5-7-15(8-6-13)20-16(19)10-18/h3-9H,10H2,1-2H3,(H2,19,20) |
| InChIKey | ANBGYRVGABGRSN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|