C9H6Cl3F3N2 — CID 169366495
2-chloro-N'-[2,4-dichloro-3-(trifluoromethyl)phenyl]ethanimidamide (PubChem CID 169366495) has the molecular formula C9H6Cl3F3N2 and a molecular weight of 305.51 g/mol. Its IUPAC name is 2-chloro-N'-[2,4-dichloro-3-(trifluoromethyl)phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[2,4-dichloro-3-(trifluoromethyl)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169366495 |
| Molecular Formula | C9H6Cl3F3N2 |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 303.95 |
| IUPAC Name | 2-chloro-N'-[2,4-dichloro-3-(trifluoromethyl)phenyl]ethanimidamide |
| SMILES | N/C(CCl)=N/c1ccc(Cl)c(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C9H6Cl3F3N2/c10-3-6(16)17-5-2-1-4(11)7(8(5)12)9(13,14)15/h1-2H,3H2,(H2,16,17) |
| InChIKey | QIHQCQBFAPXIKF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|