C10H10ClF3N2S — CID 169368162
2-chloro-N'-[2-(sulfanylmethyl)-5-(trifluoromethyl)phenyl]ethanimidamide (PubChem CID 169368162) has the molecular formula C10H10ClF3N2S and a molecular weight of 282.72 g/mol. Its IUPAC name is 2-chloro-N'-[2-(sulfanylmethyl)-5-(trifluoromethyl)phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[2-(sulfanylmethyl)-5-(trifluoromethyl)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169368162 |
| Molecular Formula | C10H10ClF3N2S |
| Molecular Weight | 282.72 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 2-chloro-N'-[2-(sulfanylmethyl)-5-(trifluoromethyl)phenyl]ethanimidamide |
| SMILES | N/C(CCl)=N/c1cc(C(F)(F)F)ccc1CS |
| InChI | InChI=1S/C10H10ClF3N2S/c11-4-9(15)16-8-3-7(10(12,13)14)2-1-6(8)5-17/h1-3,17H,4-5H2,(H2,15,16) |
| InChIKey | PWSYJQRLJNQFBH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.72 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|