C15H9BrClF5N2O — CID 169369356
N'-[2-bromo-5-[2,6-difluoro-4-(trifluoromethyl)phenoxy]phenyl]-2-chloroethanimidamide (PubChem CID 169369356) has the molecular formula C15H9BrClF5N2O and a molecular weight of 443.60 g/mol. Its IUPAC name is N'-[2-bromo-5-[2,6-difluoro-4-(trifluoromethyl)phenoxy]phenyl]-2-chloroethanimidamide.
| Compound Name | N'-[2-bromo-5-[2,6-difluoro-4-(trifluoromethyl)phenoxy]phenyl]-2-chloroethanimidamide |
|---|---|
| PubChem CID | 169369356 |
| Molecular Formula | C15H9BrClF5N2O |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 441.95 |
| IUPAC Name | N'-[2-bromo-5-[2,6-difluoro-4-(trifluoromethyl)phenoxy]phenyl]-2-chloroethanimidamide |
| SMILES | N/C(CCl)=N/c1cc(Oc2c(F)cc(C(F)(F)F)cc2F)ccc1Br |
| InChI | InChI=1S/C15H9BrClF5N2O/c16-9-2-1-8(5-12(9)24-13(23)6-17)25-14-10(18)3-7(4-11(14)19)15(20,21)22/h1-5H,6H2,(H2,23,24) |
| InChIKey | UQDYMNSNRZCSCI-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|