C18H6BrF5N4O — CID 168610416
2-[2-bromo-5-[2,6-difluoro-4-(trifluoromethyl)phenoxy]anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168610416) has the molecular formula C18H6BrF5N4O and a molecular weight of 469.17 g/mol. Its IUPAC name is 2-[2-bromo-5-[2,6-difluoro-4-(trifluoromethyl)phenoxy]anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[2-bromo-5-[2,6-difluoro-4-(trifluoromethyl)phenoxy]anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168610416 |
| Molecular Formula | C18H6BrF5N4O |
| Molecular Weight | 469.17 g/mol |
| Exact Mass | 467.96 |
| IUPAC Name | 2-[2-bromo-5-[2,6-difluoro-4-(trifluoromethyl)phenoxy]anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1cc(Oc2c(F)cc(C(F)(F)F)cc2F)ccc1Br |
| InChI | InChI=1S/C18H6BrF5N4O/c19-12-2-1-11(5-15(12)28-16(8-27)9(6-25)7-26)29-17-13(20)3-10(4-14(17)21)18(22,23)24/h1-5,28H |
| InChIKey | STFNBUPUOCMJEN-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 92.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.17 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|