C10H9ClF4N2O — CID 169367038
2-chloro-N'-[2-fluoro-5-methoxy-3-(trifluoromethyl)phenyl]ethanimidamide (PubChem CID 169367038) has the molecular formula C10H9ClF4N2O and a molecular weight of 284.64 g/mol. Its IUPAC name is 2-chloro-N'-[2-fluoro-5-methoxy-3-(trifluoromethyl)phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[2-fluoro-5-methoxy-3-(trifluoromethyl)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169367038 |
| Molecular Formula | C10H9ClF4N2O |
| Molecular Weight | 284.64 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 2-chloro-N'-[2-fluoro-5-methoxy-3-(trifluoromethyl)phenyl]ethanimidamide |
| SMILES | COc1cc(/N=C(/N)CCl)c(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9ClF4N2O/c1-18-5-2-6(10(13,14)15)9(12)7(3-5)17-8(16)4-11/h2-3H,4H2,1H3,(H2,16,17) |
| InChIKey | LHIARQGYSIWFMZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.64 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|