C10H12ClFN2 — CID 169368780
2-chloro-N'-(3-fluoro-2,4-dimethylphenyl)ethanimidamide (PubChem CID 169368780) has the molecular formula C10H12ClFN2 and a molecular weight of 214.67 g/mol. Its IUPAC name is 2-chloro-N'-(3-fluoro-2,4-dimethylphenyl)ethanimidamide.
| Compound Name | 2-chloro-N'-(3-fluoro-2,4-dimethylphenyl)ethanimidamide |
|---|---|
| PubChem CID | 169368780 |
| Molecular Formula | C10H12ClFN2 |
| Molecular Weight | 214.67 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 2-chloro-N'-(3-fluoro-2,4-dimethylphenyl)ethanimidamide |
| SMILES | Cc1ccc(/N=C(/N)CCl)c(C)c1F |
| InChI | InChI=1S/C10H12ClFN2/c1-6-3-4-8(7(2)10(6)12)14-9(13)5-11/h3-4H,5H2,1-2H3,(H2,13,14) |
| InChIKey | PRSNOPGKHOTJTL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.67 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|