C16H14ClF3N4O — CID 169368384
N'-[2-(anilinocarbamoyl)-4-(trifluoromethyl)phenyl]-2-chloroethanimidamide (PubChem CID 169368384) has the molecular formula C16H14ClF3N4O and a molecular weight of 370.76 g/mol. Its IUPAC name is N'-[2-(anilinocarbamoyl)-4-(trifluoromethyl)phenyl]-2-chloroethanimidamide.
| Compound Name | N'-[2-(anilinocarbamoyl)-4-(trifluoromethyl)phenyl]-2-chloroethanimidamide |
|---|---|
| PubChem CID | 169368384 |
| Molecular Formula | C16H14ClF3N4O |
| Molecular Weight | 370.76 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | N'-[2-(anilinocarbamoyl)-4-(trifluoromethyl)phenyl]-2-chloroethanimidamide |
| SMILES | N/C(CCl)=N/c1ccc(C(F)(F)F)cc1C(=O)NNc1ccccc1 |
| InChI | InChI=1S/C16H14ClF3N4O/c17-9-14(21)22-13-7-6-10(16(18,19)20)8-12(13)15(25)24-23-11-4-2-1-3-5-11/h1-8,23H,9H2,(H2,21,22)(H,24,25) |
| InChIKey | VTDBVAWGWXGFCD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.76 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|