C17H11F3N6O — CID 169340655
2-[2-(dicyanomethylidene)hydrazinyl]-N'-phenyl-5-(trifluoromethyl)benzohydrazide (PubChem CID 169340655) has the molecular formula C17H11F3N6O and a molecular weight of 372.31 g/mol. Its IUPAC name is 2-[2-(dicyanomethylidene)hydrazinyl]-N'-phenyl-5-(trifluoromethyl)benzohydrazide.
| Compound Name | 2-[2-(dicyanomethylidene)hydrazinyl]-N'-phenyl-5-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 169340655 |
| Molecular Formula | C17H11F3N6O |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2-[2-(dicyanomethylidene)hydrazinyl]-N'-phenyl-5-(trifluoromethyl)benzohydrazide |
| SMILES | N#CC(C#N)=NNc1ccc(C(F)(F)F)cc1C(=O)NNc1ccccc1 |
| InChI | InChI=1S/C17H11F3N6O/c18-17(19,20)11-6-7-15(25-24-13(9-21)10-22)14(8-11)16(27)26-23-12-4-2-1-3-5-12/h1-8,23,25H,(H,26,27) |
| InChIKey | OEBYKACZJHHQKK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|