C16H16F3N5 — CID 169339423
2-[[2-(4-methylpiperidin-1-yl)-5-(trifluoromethyl)phenyl]hydrazinylidene]propanedinitrile (PubChem CID 169339423) has the molecular formula C16H16F3N5 and a molecular weight of 335.33 g/mol. Its IUPAC name is 2-[[2-(4-methylpiperidin-1-yl)-5-(trifluoromethyl)phenyl]hydrazinylidene]propanedinitrile.
| Compound Name | 2-[[2-(4-methylpiperidin-1-yl)-5-(trifluoromethyl)phenyl]hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169339423 |
| Molecular Formula | C16H16F3N5 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-[[2-(4-methylpiperidin-1-yl)-5-(trifluoromethyl)phenyl]hydrazinylidene]propanedinitrile |
| SMILES | CC1CCN(c2ccc(C(F)(F)F)cc2NN=C(C#N)C#N)CC1 |
| InChI | InChI=1S/C16H16F3N5/c1-11-4-6-24(7-5-11)15-3-2-12(16(17,18)19)8-14(15)23-22-13(9-20)10-21/h2-3,8,11,23H,4-7H2,1H3 |
| InChIKey | LIYDPMQDDVTWEJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|