C16H17N5O2 — CID 169338216
4-(azepan-1-yl)-3-[2-(dicyanomethylidene)hydrazinyl]benzoic acid (PubChem CID 169338216) has the molecular formula C16H17N5O2 and a molecular weight of 311.35 g/mol. Its IUPAC name is 4-(azepan-1-yl)-3-[2-(dicyanomethylidene)hydrazinyl]benzoic acid.
| Compound Name | 4-(azepan-1-yl)-3-[2-(dicyanomethylidene)hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 169338216 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 4-(azepan-1-yl)-3-[2-(dicyanomethylidene)hydrazinyl]benzoic acid |
| SMILES | N#CC(C#N)=NNc1cc(C(=O)O)ccc1N1CCCCCC1 |
| InChI | InChI=1S/C16H17N5O2/c17-10-13(11-18)19-20-14-9-12(16(22)23)5-6-15(14)21-7-3-1-2-4-8-21/h5-6,9,20H,1-4,7-8H2,(H,22,23) |
| InChIKey | JKSMJZWNAASGIZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 112.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|