C16H19F3N6O — CID 172976449
(1Z)-2-amino-N-[2-(2,6-dimethylmorpholin-4-yl)-5-(trifluoromethyl)anilino]-2-iminoethanimidoyl cyanide (PubChem CID 172976449) has the molecular formula C16H19F3N6O and a molecular weight of 368.36 g/mol. Its IUPAC name is (1Z)-2-amino-N-[2-(2,6-dimethylmorpholin-4-yl)-5-(trifluoromethyl)anilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[2-(2,6-dimethylmorpholin-4-yl)-5-(trifluoromethyl)anilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172976449 |
| Molecular Formula | C16H19F3N6O |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (1Z)-2-amino-N-[2-(2,6-dimethylmorpholin-4-yl)-5-(trifluoromethyl)anilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cc(C(F)(F)F)ccc1N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C16H19F3N6O/c1-9-7-25(8-10(2)26-9)14-4-3-11(16(17,18)19)5-12(14)23-24-13(6-20)15(21)22/h3-5,9-10,23H,7-8H2,1-2H3,(H3,21,22)/b24-13+ |
| InChIKey | FBSKLOFMBJOACL-ZMOGYAJESA-N |
| XLogP | 2.55 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|