C17H13F3N6O — CID 172978763
(1Z)-2-amino-2-imino-N-[2-[[4-(trifluoromethyl)benzoyl]amino]anilino]ethanimidoyl cyanide (PubChem CID 172978763) has the molecular formula C17H13F3N6O and a molecular weight of 374.33 g/mol. Its IUPAC name is (1Z)-2-amino-2-imino-N-[2-[[4-(trifluoromethyl)benzoyl]amino]anilino]ethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-2-imino-N-[2-[[4-(trifluoromethyl)benzoyl]amino]anilino]ethanimidoyl cyanide |
|---|---|
| PubChem CID | 172978763 |
| Molecular Formula | C17H13F3N6O |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | (1Z)-2-amino-2-imino-N-[2-[[4-(trifluoromethyl)benzoyl]amino]anilino]ethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccccc1NC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13F3N6O/c18-17(19,20)11-7-5-10(6-8-11)16(27)24-12-3-1-2-4-13(12)25-26-14(9-21)15(22)23/h1-8,25H,(H3,22,23)(H,24,27)/b26-14+ |
| InChIKey | KCOJABFGXCNTPT-VULFUBBASA-N |
| XLogP | 3.19 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|