About 2-chloro-4-fluoro-N'-phenylbenzohydrazide
2-chloro-4-fluoro-N'-phenylbenzohydrazide (PubChem CID 78774979) has the molecular formula C13H10ClFN2O
and a molecular weight of 264.69 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N'-phenylbenzohydrazide.
Molecular Properties
| Compound Name | 2-chloro-4-fluoro-N'-phenylbenzohydrazide |
| PubChem CID | 78774979 |
| Molecular Formula | C13H10ClFN2O |
| Molecular Weight | 264.69 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 2-chloro-4-fluoro-N'-phenylbenzohydrazide |
| SMILES | O=C(NNc1ccccc1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C13H10ClFN2O/c14-12-8-9(15)6-7-11(12)13(18)17-16-10-4-2-1-3-5-10/h1-8,16H,(H,17,18) |
| InChIKey | VQJDZXSNOJXWRH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.69 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-fluoro-N'-phenylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-fluoro-N'-phenylbenzohydrazide?
The IUPAC name of 2-chloro-4-fluoro-N'-phenylbenzohydrazide (CID 78774979) is 2-chloro-4-fluoro-N'-phenylbenzohydrazide.
What is the SMILES notation for 2-chloro-4-fluoro-N'-phenylbenzohydrazide?
The canonical SMILES for 2-chloro-4-fluoro-N'-phenylbenzohydrazide is O=C(NNc1ccccc1)c1ccc(F)cc1Cl.
What is the InChIKey of 2-chloro-4-fluoro-N'-phenylbenzohydrazide?
The InChIKey is VQJDZXSNOJXWRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClFN2O/c14-12-8-9(15)6-7-11(12)13(18)17-16-10-4-2-1-3-5-10/h1-8,16H,(H,17,18).
What are the key properties of 2-chloro-4-fluoro-N'-phenylbenzohydrazide?
2-chloro-4-fluoro-N'-phenylbenzohydrazide has a molecular weight of 264.69 g/mol, XLogP of 3.24, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-fluoro-N'-phenylbenzohydrazide is sourced from PubChem (CID 78774979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).