C22H29ClN2 — CID 169365728
N'-[5-tert-butyl-2-(4-tert-butylphenyl)phenyl]-2-chloroethanimidamide (PubChem CID 169365728) has the molecular formula C22H29ClN2 and a molecular weight of 356.94 g/mol. Its IUPAC name is N'-[5-tert-butyl-2-(4-tert-butylphenyl)phenyl]-2-chloroethanimidamide.
| Compound Name | N'-[5-tert-butyl-2-(4-tert-butylphenyl)phenyl]-2-chloroethanimidamide |
|---|---|
| PubChem CID | 169365728 |
| Molecular Formula | C22H29ClN2 |
| Molecular Weight | 356.94 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | N'-[5-tert-butyl-2-(4-tert-butylphenyl)phenyl]-2-chloroethanimidamide |
| SMILES | CC(C)(C)c1ccc(-c2ccc(C(C)(C)C)cc2/N=C(/N)CCl)cc1 |
| InChI | InChI=1S/C22H29ClN2/c1-21(2,3)16-9-7-15(8-10-16)18-12-11-17(22(4,5)6)13-19(18)25-20(24)14-23/h7-13H,14H2,1-6H3,(H2,24,25) |
| InChIKey | OATDLTCYTHHHHH-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.94 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|