C19H20ClF3N4 — CID 169367697
2-chloro-N'-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]phenyl]ethanimidamide (PubChem CID 169367697) has the molecular formula C19H20ClF3N4 and a molecular weight of 396.84 g/mol. Its IUPAC name is 2-chloro-N'-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169367697 |
| Molecular Formula | C19H20ClF3N4 |
| Molecular Weight | 396.84 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2-chloro-N'-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]phenyl]ethanimidamide |
| SMILES | N/C(CCl)=N/c1ccc(N2CCN(c3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C19H20ClF3N4/c20-13-18(24)25-15-4-6-16(7-5-15)26-8-10-27(11-9-26)17-3-1-2-14(12-17)19(21,22)23/h1-7,12H,8-11,13H2,(H2,24,25) |
| InChIKey | LOEQYCIYMPTUOT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.84 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|