C10H10ClF6N5 — CID 135410038
[N'-[3,5-bis(trifluoromethyl)phenyl]carbamimidoyl]-(diaminomethylidene)azanium chloride (PubChem CID 135410038) has the molecular formula C10H10ClF6N5 and a molecular weight of 349.67 g/mol. Its IUPAC name is [N'-[3,5-bis(trifluoromethyl)phenyl]carbamimidoyl]-(diaminomethylidene)azanium chloride.
| Compound Name | [N'-[3,5-bis(trifluoromethyl)phenyl]carbamimidoyl]-(diaminomethylidene)azanium chloride |
|---|---|
| PubChem CID | 135410038 |
| Molecular Formula | C10H10ClF6N5 |
| Molecular Weight | 349.67 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | [N'-[3,5-bis(trifluoromethyl)phenyl]carbamimidoyl]-(diaminomethylidene)azanium chloride |
| SMILES | NC(N)=[NH+]/C(N)=N/c1cc(C(F)(F)F)cc(C(F)(F)F)c1.[Cl-] |
| InChI | InChI=1S/C10H9F6N5.ClH/c11-9(12,13)4-1-5(10(14,15)16)3-6(2-4)20-8(19)21-7(17)18;/h1-3H,(H6,17,18,19,20,21);1H |
| InChIKey | VEHPYWMGWYCGTE-UHFFFAOYSA-N |
| XLogP | -2.97 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.67 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|