C11H11F6N3O — CID 143169593
2-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-N'-(methylamino)ethanimidamide (PubChem CID 143169593) has the molecular formula C11H11F6N3O and a molecular weight of 315.22 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-N'-(methylamino)ethanimidamide.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-N'-(methylamino)ethanimidamide |
|---|---|
| PubChem CID | 143169593 |
| Molecular Formula | C11H11F6N3O |
| Molecular Weight | 315.22 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-N'-(methylamino)ethanimidamide |
| SMILES | CN/N=C(\N)C(O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11F6N3O/c1-19-20-9(18)8(21)5-2-6(10(12,13)14)4-7(3-5)11(15,16)17/h2-4,8,19,21H,1H3,(H2,18,20) |
| InChIKey | XKBFUWLTUMVCDB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|