C12H13F6NS — CID 64615079
1-[3,5-bis(trifluoromethyl)phenyl]-2-ethylsulfanylethanamine (PubChem CID 64615079) has the molecular formula C12H13F6NS and a molecular weight of 317.30 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-2-ethylsulfanylethanamine.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-2-ethylsulfanylethanamine |
|---|---|
| PubChem CID | 64615079 |
| Molecular Formula | C12H13F6NS |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-2-ethylsulfanylethanamine |
| SMILES | CCSCC(N)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F6NS/c1-2-20-6-10(19)7-3-8(11(13,14)15)5-9(4-7)12(16,17)18/h3-5,10H,2,6,19H2,1H3 |
| InChIKey | WKFREFFCUNXCPW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |