C17H7F12N2Se — CID 171057101
CID 171057101 (PubChem CID 171057101) has the molecular formula C17H7F12N2Se and a molecular weight of 546.19 g/mol.
| Compound Name | CID 171057101 |
|---|---|
| PubChem CID | 171057101 |
| Molecular Formula | C17H7F12N2Se |
| Molecular Weight | 546.19 g/mol |
| Exact Mass | 546.96 |
| IUPAC Name | — |
| SMILES | FC(F)(F)c1cc(/N=C(\[Se])Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H7F12N2Se/c18-14(19,20)7-1-8(15(21,22)23)4-11(3-7)30-13(32)31-12-5-9(16(24,25)26)2-10(6-12)17(27,28)29/h1-6H,(H,30,31) |
| InChIKey | XQGAAHWYEQVDGI-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.19 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|