C9H8F6N2O — CID 166475338
amino-[3,5-bis(trifluoromethyl)anilino]methanol (PubChem CID 166475338) has the molecular formula C9H8F6N2O and a molecular weight of 274.16 g/mol. Its IUPAC name is amino-[3,5-bis(trifluoromethyl)anilino]methanol.
| Compound Name | amino-[3,5-bis(trifluoromethyl)anilino]methanol |
|---|---|
| PubChem CID | 166475338 |
| Molecular Formula | C9H8F6N2O |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | amino-[3,5-bis(trifluoromethyl)anilino]methanol |
| SMILES | NC(O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H8F6N2O/c10-8(11,12)4-1-5(9(13,14)15)3-6(2-4)17-7(16)18/h1-3,7,17-18H,16H2 |
| InChIKey | XTINOGYAGZOYLM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|