C10H13F3N2O2 — CID 123778548
1-[3-amino-5-(trifluoromethyl)anilino]-2-methoxyethanol (PubChem CID 123778548) has the molecular formula C10H13F3N2O2 and a molecular weight of 250.22 g/mol. Its IUPAC name is 1-[3-amino-5-(trifluoromethyl)anilino]-2-methoxyethanol.
| Compound Name | 1-[3-amino-5-(trifluoromethyl)anilino]-2-methoxyethanol |
|---|---|
| PubChem CID | 123778548 |
| Molecular Formula | C10H13F3N2O2 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 1-[3-amino-5-(trifluoromethyl)anilino]-2-methoxyethanol |
| SMILES | COCC(O)Nc1cc(N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H13F3N2O2/c1-17-5-9(16)15-8-3-6(10(11,12)13)2-7(14)4-8/h2-4,9,15-16H,5,14H2,1H3 |
| InChIKey | SNSCHUXJXXQIDB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|