C11H17FN2O2 — CID 106243117
4-(3-amino-5-fluoroanilino)-1-methoxybutan-2-ol (PubChem CID 106243117) has the molecular formula C11H17FN2O2 and a molecular weight of 228.27 g/mol. Its IUPAC name is 4-(3-amino-5-fluoroanilino)-1-methoxybutan-2-ol.
| Compound Name | 4-(3-amino-5-fluoroanilino)-1-methoxybutan-2-ol |
|---|---|
| PubChem CID | 106243117 |
| Molecular Formula | C11H17FN2O2 |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 4-(3-amino-5-fluoroanilino)-1-methoxybutan-2-ol |
| SMILES | COCC(O)CCNc1cc(N)cc(F)c1 |
| InChI | InChI=1S/C11H17FN2O2/c1-16-7-11(15)2-3-14-10-5-8(12)4-9(13)6-10/h4-6,11,14-15H,2-3,7,13H2,1H3 |
| InChIKey | BWDIKMNYJTYLPM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|