C16H18F3N7O — CID 89082256
6-N-[3-amino-5-(trifluoromethyl)phenyl]-8-N-(2-methoxyethyl)imidazo[1,2-b]pyridazine-3,6,8-triamine (PubChem CID 89082256) has the molecular formula C16H18F3N7O and a molecular weight of 381.36 g/mol. Its IUPAC name is 6-N-[3-amino-5-(trifluoromethyl)phenyl]-8-N-(2-methoxyethyl)imidazo[1,2-b]pyridazine-3,6,8-triamine.
| Compound Name | 6-N-[3-amino-5-(trifluoromethyl)phenyl]-8-N-(2-methoxyethyl)imidazo[1,2-b]pyridazine-3,6,8-triamine |
|---|---|
| PubChem CID | 89082256 |
| Molecular Formula | C16H18F3N7O |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 6-N-[3-amino-5-(trifluoromethyl)phenyl]-8-N-(2-methoxyethyl)imidazo[1,2-b]pyridazine-3,6,8-triamine |
| SMILES | COCCNc1cc(Nc2cc(N)cc(C(F)(F)F)c2)nn2c(N)cnc12 |
| InChI | InChI=1S/C16H18F3N7O/c1-27-3-2-22-12-7-14(25-26-13(21)8-23-15(12)26)24-11-5-9(16(17,18)19)4-10(20)6-11/h4-8,22H,2-3,20-21H2,1H3,(H,24,25) |
| InChIKey | LQSMAZXWGOKZMN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 115.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|