C18H21N7O — CID 70900932
N-[5-[[3-amino-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-2-methylphenyl]acetamide (PubChem CID 70900932) has the molecular formula C18H21N7O and a molecular weight of 351.41 g/mol. Its IUPAC name is N-[5-[[3-amino-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-2-methylphenyl]acetamide.
| Compound Name | N-[5-[[3-amino-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-2-methylphenyl]acetamide |
|---|---|
| PubChem CID | 70900932 |
| Molecular Formula | C18H21N7O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | N-[5-[[3-amino-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-2-methylphenyl]acetamide |
| SMILES | CC(=O)Nc1cc(Nc2cc(NC3CC3)c3ncc(N)n3n2)ccc1C |
| InChI | InChI=1S/C18H21N7O/c1-10-3-4-13(7-14(10)21-11(2)26)23-17-8-15(22-12-5-6-12)18-20-9-16(19)25(18)24-17/h3-4,7-9,12,22H,5-6,19H2,1-2H3,(H,21,26)(H,23,24) |
| InChIKey | FLJSCMHMXVSVRF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 109.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|