C19H19N7O2 — CID 59314022
methyl N-[3-[[3-cyano-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-4-methylphenyl]carbamate (PubChem CID 59314022) has the molecular formula C19H19N7O2 and a molecular weight of 377.41 g/mol. Its IUPAC name is methyl N-[3-[[3-cyano-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-4-methylphenyl]carbamate.
| Compound Name | methyl N-[3-[[3-cyano-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-4-methylphenyl]carbamate |
|---|---|
| PubChem CID | 59314022 |
| Molecular Formula | C19H19N7O2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | methyl N-[3-[[3-cyano-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-4-methylphenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(C)c(Nc2cc(NC3CC3)c3ncc(C#N)n3n2)c1 |
| InChI | InChI=1S/C19H19N7O2/c1-11-3-4-13(23-19(27)28-2)7-15(11)24-17-8-16(22-12-5-6-12)18-21-10-14(9-20)26(18)25-17/h3-4,7-8,10,12,22H,5-6H2,1-2H3,(H,23,27)(H,24,25) |
| InChIKey | CXNNFSHNWXEWTO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 116.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|