C16H15N7O2S — CID 67358031
3-cyano-8-(cyclopropylamino)-6-[3-(sulfinoamino)anilino]imidazo[1,2-b]pyridazine (PubChem CID 67358031) has the molecular formula C16H15N7O2S and a molecular weight of 369.41 g/mol. Its IUPAC name is 3-cyano-8-(cyclopropylamino)-6-[3-(sulfinoamino)anilino]imidazo[1,2-b]pyridazine.
| Compound Name | 3-cyano-8-(cyclopropylamino)-6-[3-(sulfinoamino)anilino]imidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 67358031 |
| Molecular Formula | C16H15N7O2S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 3-cyano-8-(cyclopropylamino)-6-[3-(sulfinoamino)anilino]imidazo[1,2-b]pyridazine |
| SMILES | N#Cc1cnc2c(NC3CC3)cc(Nc3cccc(NS(=O)O)c3)nn12 |
| InChI | InChI=1S/C16H15N7O2S/c17-8-13-9-18-16-14(19-10-4-5-10)7-15(21-23(13)16)20-11-2-1-3-12(6-11)22-26(24)25/h1-3,6-7,9-10,19,22H,4-5H2,(H,20,21)(H,24,25) |
| InChIKey | BXULETRRZPVPSQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 127.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|