C17H16FN7OS — CID 143973962
N-[5-[[3-cyano-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-2-fluorophenyl]methanesulfinamide (PubChem CID 143973962) has the molecular formula C17H16FN7OS and a molecular weight of 385.43 g/mol. Its IUPAC name is N-[5-[[3-cyano-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-2-fluorophenyl]methanesulfinamide.
| Compound Name | N-[5-[[3-cyano-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-2-fluorophenyl]methanesulfinamide |
|---|---|
| PubChem CID | 143973962 |
| Molecular Formula | C17H16FN7OS |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-[5-[[3-cyano-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-2-fluorophenyl]methanesulfinamide |
| SMILES | CS(=O)Nc1cc(Nc2cc(NC3CC3)c3ncc(C#N)n3n2)ccc1F |
| InChI | InChI=1S/C17H16FN7OS/c1-27(26)24-14-6-11(4-5-13(14)18)22-16-7-15(21-10-2-3-10)17-20-9-12(8-19)25(17)23-16/h4-7,9-10,21,24H,2-3H2,1H3,(H,22,23) |
| InChIKey | IWAJEYBSUMYBML-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 107.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|