C18H16N8O — CID 59314034
[3-[[3-cyano-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-5-methoxyphenyl]cyanamide (PubChem CID 59314034) has the molecular formula C18H16N8O and a molecular weight of 360.38 g/mol. Its IUPAC name is [3-[[3-cyano-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-5-methoxyphenyl]cyanamide.
| Compound Name | [3-[[3-cyano-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-5-methoxyphenyl]cyanamide |
|---|---|
| PubChem CID | 59314034 |
| Molecular Formula | C18H16N8O |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | [3-[[3-cyano-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-5-methoxyphenyl]cyanamide |
| SMILES | COc1cc(NC#N)cc(Nc2cc(NC3CC3)c3ncc(C#N)n3n2)c1 |
| InChI | InChI=1S/C18H16N8O/c1-27-15-5-12(22-10-20)4-13(6-15)24-17-7-16(23-11-2-3-11)18-21-9-14(8-19)26(18)25-17/h4-7,9,11,22-23H,2-3H2,1H3,(H,24,25) |
| InChIKey | KVWOUBDICLQECB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 123.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|