C24H26N8O4 — CID 91016649
[3-[[3-cyano-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-5-(oxan-4-ylcarbamoyl)phenyl] N-methylcarbamate (PubChem CID 91016649) has the molecular formula C24H26N8O4 and a molecular weight of 490.52 g/mol. Its IUPAC name is [3-[[3-cyano-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-5-(oxan-4-ylcarbamoyl)phenyl] N-methylcarbamate.
| Compound Name | [3-[[3-cyano-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-5-(oxan-4-ylcarbamoyl)phenyl] N-methylcarbamate |
|---|---|
| PubChem CID | 91016649 |
| Molecular Formula | C24H26N8O4 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | [3-[[3-cyano-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-5-(oxan-4-ylcarbamoyl)phenyl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1cc(Nc2cc(NC3CC3)c3ncc(C#N)n3n2)cc(C(=O)NC2CCOCC2)c1 |
| InChI | InChI=1S/C24H26N8O4/c1-26-24(34)36-19-9-14(23(33)30-16-4-6-35-7-5-16)8-17(10-19)29-21-11-20(28-15-2-3-15)22-27-13-18(12-25)32(22)31-21/h8-11,13,15-16,28H,2-7H2,1H3,(H,26,34)(H,29,31)(H,30,33) |
| InChIKey | MQKUAWOIPPXDNB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 154.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|