C18H15N7 — CID 59313875
6-(5-cyano-2-methylanilino)-8-(cyclopropylamino)imidazo[1,2-b]pyridazine-3-carbonitrile (PubChem CID 59313875) has the molecular formula C18H15N7 and a molecular weight of 329.37 g/mol. Its IUPAC name is 6-(5-cyano-2-methylanilino)-8-(cyclopropylamino)imidazo[1,2-b]pyridazine-3-carbonitrile.
| Compound Name | 6-(5-cyano-2-methylanilino)-8-(cyclopropylamino)imidazo[1,2-b]pyridazine-3-carbonitrile |
|---|---|
| PubChem CID | 59313875 |
| Molecular Formula | C18H15N7 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 6-(5-cyano-2-methylanilino)-8-(cyclopropylamino)imidazo[1,2-b]pyridazine-3-carbonitrile |
| SMILES | Cc1ccc(C#N)cc1Nc1cc(NC2CC2)c2ncc(C#N)n2n1 |
| InChI | InChI=1S/C18H15N7/c1-11-2-3-12(8-19)6-15(11)23-17-7-16(22-13-4-5-13)18-21-10-14(9-20)25(18)24-17/h2-3,6-7,10,13,22H,4-5H2,1H3,(H,23,24) |
| InChIKey | VJTUZMKWQGEZPL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|