C14H10N8S — CID 59314051
2-[[3-cyano-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-1,3-thiazole-5-carbonitrile (PubChem CID 59314051) has the molecular formula C14H10N8S and a molecular weight of 322.36 g/mol. Its IUPAC name is 2-[[3-cyano-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-1,3-thiazole-5-carbonitrile.
| Compound Name | 2-[[3-cyano-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 59314051 |
| Molecular Formula | C14H10N8S |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 2-[[3-cyano-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-1,3-thiazole-5-carbonitrile |
| SMILES | N#Cc1cnc(Nc2cc(NC3CC3)c3ncc(C#N)n3n2)s1 |
| InChI | InChI=1S/C14H10N8S/c15-4-9-6-17-13-11(19-8-1-2-8)3-12(21-22(9)13)20-14-18-7-10(5-16)23-14/h3,6-8,19H,1-2H2,(H,18,20,21) |
| InChIKey | IPYLVZFHJMUSFE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|