C18H12F3N7 — CID 59313968
6-[4-cyano-3-(trifluoromethyl)anilino]-8-(cyclopropylamino)imidazo[1,2-b]pyridazine-3-carbonitrile (PubChem CID 59313968) has the molecular formula C18H12F3N7 and a molecular weight of 383.34 g/mol. Its IUPAC name is 6-[4-cyano-3-(trifluoromethyl)anilino]-8-(cyclopropylamino)imidazo[1,2-b]pyridazine-3-carbonitrile.
| Compound Name | 6-[4-cyano-3-(trifluoromethyl)anilino]-8-(cyclopropylamino)imidazo[1,2-b]pyridazine-3-carbonitrile |
|---|---|
| PubChem CID | 59313968 |
| Molecular Formula | C18H12F3N7 |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 6-[4-cyano-3-(trifluoromethyl)anilino]-8-(cyclopropylamino)imidazo[1,2-b]pyridazine-3-carbonitrile |
| SMILES | N#Cc1ccc(Nc2cc(NC3CC3)c3ncc(C#N)n3n2)cc1C(F)(F)F |
| InChI | InChI=1S/C18H12F3N7/c19-18(20,21)14-5-12(2-1-10(14)7-22)26-16-6-15(25-11-3-4-11)17-24-9-13(8-23)28(17)27-16/h1-2,5-6,9,11,25H,3-4H2,(H,26,27) |
| InChIKey | VSWAPVNEGKPJSC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|