C16H16F3N7 — CID 89082126
6-N-[3-amino-4-(trifluoromethyl)phenyl]-8-N-cyclopropylimidazo[1,2-b]pyridazine-3,6,8-triamine (PubChem CID 89082126) has the molecular formula C16H16F3N7 and a molecular weight of 363.35 g/mol. Its IUPAC name is 6-N-[3-amino-4-(trifluoromethyl)phenyl]-8-N-cyclopropylimidazo[1,2-b]pyridazine-3,6,8-triamine.
| Compound Name | 6-N-[3-amino-4-(trifluoromethyl)phenyl]-8-N-cyclopropylimidazo[1,2-b]pyridazine-3,6,8-triamine |
|---|---|
| PubChem CID | 89082126 |
| Molecular Formula | C16H16F3N7 |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 6-N-[3-amino-4-(trifluoromethyl)phenyl]-8-N-cyclopropylimidazo[1,2-b]pyridazine-3,6,8-triamine |
| SMILES | Nc1cc(Nc2cc(NC3CC3)c3ncc(N)n3n2)ccc1C(F)(F)F |
| InChI | InChI=1S/C16H16F3N7/c17-16(18,19)10-4-3-9(5-11(10)20)24-14-6-12(23-8-1-2-8)15-22-7-13(21)26(15)25-14/h3-8,23H,1-2,20-21H2,(H,24,25) |
| InChIKey | GIALSWOYAUGKOA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 106.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|