C22H29N11 — CID 70900887
8-N-cyclopropyl-6-N-[4-[2-(dimethylamino)ethyl-methylamino]-3-(1,2,4-triazol-4-yl)phenyl]imidazo[1,2-b]pyridazine-3,6,8-triamine (PubChem CID 70900887) has the molecular formula C22H29N11 and a molecular weight of 447.55 g/mol. Its IUPAC name is 8-N-cyclopropyl-6-N-[4-[2-(dimethylamino)ethyl-methylamino]-3-(1,2,4-triazol-4-yl)phenyl]imidazo[1,2-b]pyridazine-3,6,8-triamine.
| Compound Name | 8-N-cyclopropyl-6-N-[4-[2-(dimethylamino)ethyl-methylamino]-3-(1,2,4-triazol-4-yl)phenyl]imidazo[1,2-b]pyridazine-3,6,8-triamine |
|---|---|
| PubChem CID | 70900887 |
| Molecular Formula | C22H29N11 |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | 8-N-cyclopropyl-6-N-[4-[2-(dimethylamino)ethyl-methylamino]-3-(1,2,4-triazol-4-yl)phenyl]imidazo[1,2-b]pyridazine-3,6,8-triamine |
| SMILES | CN(C)CCN(C)c1ccc(Nc2cc(NC3CC3)c3ncc(N)n3n2)cc1-n1cnnc1 |
| InChI | InChI=1S/C22H29N11/c1-30(2)8-9-31(3)18-7-6-16(10-19(18)32-13-25-26-14-32)28-21-11-17(27-15-4-5-15)22-24-12-20(23)33(22)29-21/h6-7,10-15,27H,4-5,8-9,23H2,1-3H3,(H,28,29) |
| InChIKey | ACUVGCDIFIDMAE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|