C22H20N8O2 — CID 59313878
N-[5-[[3-isocyano-8-[(5-methoxy-2-pyridinyl)amino]imidazo[1,2-b]pyridazin-6-yl]amino]-2-methylphenyl]acetamide (PubChem CID 59313878) has the molecular formula C22H20N8O2 and a molecular weight of 428.46 g/mol. Its IUPAC name is N-[5-[[3-isocyano-8-[(5-methoxy-2-pyridinyl)amino]imidazo[1,2-b]pyridazin-6-yl]amino]-2-methylphenyl]acetamide.
| Compound Name | N-[5-[[3-isocyano-8-[(5-methoxy-2-pyridinyl)amino]imidazo[1,2-b]pyridazin-6-yl]amino]-2-methylphenyl]acetamide |
|---|---|
| PubChem CID | 59313878 |
| Molecular Formula | C22H20N8O2 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | N-[5-[[3-isocyano-8-[(5-methoxy-2-pyridinyl)amino]imidazo[1,2-b]pyridazin-6-yl]amino]-2-methylphenyl]acetamide |
| SMILES | [C-]#[N+]c1cnc2c(Nc3ccc(OC)cn3)cc(Nc3ccc(C)c(NC(C)=O)c3)nn12 |
| InChI | InChI=1S/C22H20N8O2/c1-13-5-6-15(9-17(13)26-14(2)31)27-20-10-18(22-25-12-21(23-3)30(22)29-20)28-19-8-7-16(32-4)11-24-19/h5-12H,1-2,4H3,(H,24,28)(H,26,31)(H,27,29) |
| InChIKey | NPQJDMIUPLJTOM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|