C18H22N10O2 — CID 70901021
8-N-(2-methoxyethyl)-6-N-[3-methoxy-5-(5-methyltetrazol-1-yl)phenyl]imidazo[1,2-b]pyridazine-3,6,8-triamine (PubChem CID 70901021) has the molecular formula C18H22N10O2 and a molecular weight of 410.44 g/mol. Its IUPAC name is 8-N-(2-methoxyethyl)-6-N-[3-methoxy-5-(5-methyltetrazol-1-yl)phenyl]imidazo[1,2-b]pyridazine-3,6,8-triamine.
| Compound Name | 8-N-(2-methoxyethyl)-6-N-[3-methoxy-5-(5-methyltetrazol-1-yl)phenyl]imidazo[1,2-b]pyridazine-3,6,8-triamine |
|---|---|
| PubChem CID | 70901021 |
| Molecular Formula | C18H22N10O2 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 8-N-(2-methoxyethyl)-6-N-[3-methoxy-5-(5-methyltetrazol-1-yl)phenyl]imidazo[1,2-b]pyridazine-3,6,8-triamine |
| SMILES | COCCNc1cc(Nc2cc(OC)cc(-n3nnnc3C)c2)nn2c(N)cnc12 |
| InChI | InChI=1S/C18H22N10O2/c1-11-23-25-26-27(11)13-6-12(7-14(8-13)30-3)22-17-9-15(20-4-5-29-2)18-21-10-16(19)28(18)24-17/h6-10,20H,4-5,19H2,1-3H3,(H,22,24) |
| InChIKey | WPYSHZMOAVVBMI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 142.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|