C13H19N7O4S — CID 72879134
1-[2-(methanesulfonamido)ethyl]-3-[3-methoxy-5-(5-methyltetrazol-1-yl)phenyl]urea (PubChem CID 72879134) has the molecular formula C13H19N7O4S and a molecular weight of 369.41 g/mol. Its IUPAC name is 1-[2-(methanesulfonamido)ethyl]-3-[3-methoxy-5-(5-methyltetrazol-1-yl)phenyl]urea.
| Compound Name | 1-[2-(methanesulfonamido)ethyl]-3-[3-methoxy-5-(5-methyltetrazol-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 72879134 |
| Molecular Formula | C13H19N7O4S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 1-[2-(methanesulfonamido)ethyl]-3-[3-methoxy-5-(5-methyltetrazol-1-yl)phenyl]urea |
| SMILES | COc1cc(NC(=O)NCCNS(C)(=O)=O)cc(-n2nnnc2C)c1 |
| InChI | InChI=1S/C13H19N7O4S/c1-9-17-18-19-20(9)11-6-10(7-12(8-11)24-2)16-13(21)14-4-5-15-25(3,22)23/h6-8,15H,4-5H2,1-3H3,(H2,14,16,21) |
| InChIKey | ZQBTUYFOMXOBDX-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 140.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|