C12H17N3O4S — CID 47022405
1-(4-acetylphenyl)-3-[2-(methanesulfonamido)ethyl]urea (PubChem CID 47022405) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-3-[2-(methanesulfonamido)ethyl]urea.
| Compound Name | 1-(4-acetylphenyl)-3-[2-(methanesulfonamido)ethyl]urea |
|---|---|
| PubChem CID | 47022405 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 1-(4-acetylphenyl)-3-[2-(methanesulfonamido)ethyl]urea |
| SMILES | CC(=O)c1ccc(NC(=O)NCCNS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H17N3O4S/c1-9(16)10-3-5-11(6-4-10)15-12(17)13-7-8-14-20(2,18)19/h3-6,14H,7-8H2,1-2H3,(H2,13,15,17) |
| InChIKey | UFHXNVZUCHFIFN-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|