C13H19N3O5S — CID 74241298
ethyl 4-[2-(methanesulfonamido)ethylcarbamoylamino]benzoate (PubChem CID 74241298) has the molecular formula C13H19N3O5S and a molecular weight of 329.38 g/mol. Its IUPAC name is ethyl 4-[2-(methanesulfonamido)ethylcarbamoylamino]benzoate.
| Compound Name | ethyl 4-[2-(methanesulfonamido)ethylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 74241298 |
| Molecular Formula | C13H19N3O5S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | ethyl 4-[2-(methanesulfonamido)ethylcarbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)NCCNS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H19N3O5S/c1-3-21-12(17)10-4-6-11(7-5-10)16-13(18)14-8-9-15-22(2,19)20/h4-7,15H,3,8-9H2,1-2H3,(H2,14,16,18) |
| InChIKey | URFMZICDFBUJMX-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|