C10H14N4O5S — CID 63157529
5-[2-(methanesulfonamido)ethylcarbamoylamino]pyridine-3-carboxylic acid (PubChem CID 63157529) has the molecular formula C10H14N4O5S and a molecular weight of 302.31 g/mol. Its IUPAC name is 5-[2-(methanesulfonamido)ethylcarbamoylamino]pyridine-3-carboxylic acid.
| Compound Name | 5-[2-(methanesulfonamido)ethylcarbamoylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63157529 |
| Molecular Formula | C10H14N4O5S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 5-[2-(methanesulfonamido)ethylcarbamoylamino]pyridine-3-carboxylic acid |
| SMILES | CS(=O)(=O)NCCNC(=O)Nc1cncc(C(=O)O)c1 |
| InChI | InChI=1S/C10H14N4O5S/c1-20(18,19)13-3-2-12-10(17)14-8-4-7(9(15)16)5-11-6-8/h4-6,13H,2-3H2,1H3,(H,15,16)(H2,12,14,17) |
| InChIKey | LNQVURUYRIVIOI-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 137.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|