C12H13N3O3 — CID 106222767
5-(pent-4-ynylcarbamoylamino)pyridine-3-carboxylic acid (PubChem CID 106222767) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 5-(pent-4-ynylcarbamoylamino)pyridine-3-carboxylic acid.
| Compound Name | 5-(pent-4-ynylcarbamoylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 106222767 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 5-(pent-4-ynylcarbamoylamino)pyridine-3-carboxylic acid |
| SMILES | C#CCCCNC(=O)Nc1cncc(C(=O)O)c1 |
| InChI | InChI=1S/C12H13N3O3/c1-2-3-4-5-14-12(18)15-10-6-9(11(16)17)7-13-8-10/h1,6-8H,3-5H2,(H,16,17)(H2,14,15,18) |
| InChIKey | RFNZSAVXSLPQLP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|