C10H13N3O5S — CID 63157485
5-(2-methylsulfonylethylcarbamoylamino)pyridine-3-carboxylic acid (PubChem CID 63157485) has the molecular formula C10H13N3O5S and a molecular weight of 287.30 g/mol. Its IUPAC name is 5-(2-methylsulfonylethylcarbamoylamino)pyridine-3-carboxylic acid.
| Compound Name | 5-(2-methylsulfonylethylcarbamoylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63157485 |
| Molecular Formula | C10H13N3O5S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 5-(2-methylsulfonylethylcarbamoylamino)pyridine-3-carboxylic acid |
| SMILES | CS(=O)(=O)CCNC(=O)Nc1cncc(C(=O)O)c1 |
| InChI | InChI=1S/C10H13N3O5S/c1-19(17,18)3-2-12-10(16)13-8-4-7(9(14)15)5-11-6-8/h4-6H,2-3H2,1H3,(H,14,15)(H2,12,13,16) |
| InChIKey | GKRKJARLLDHMTH-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |