C11H14ClN3O5S — CID 61399177
2-chloro-4-[2-(methanesulfonamido)ethylcarbamoylamino]benzoic acid (PubChem CID 61399177) has the molecular formula C11H14ClN3O5S and a molecular weight of 335.77 g/mol. Its IUPAC name is 2-chloro-4-[2-(methanesulfonamido)ethylcarbamoylamino]benzoic acid.
| Compound Name | 2-chloro-4-[2-(methanesulfonamido)ethylcarbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 61399177 |
| Molecular Formula | C11H14ClN3O5S |
| Molecular Weight | 335.77 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 2-chloro-4-[2-(methanesulfonamido)ethylcarbamoylamino]benzoic acid |
| SMILES | CS(=O)(=O)NCCNC(=O)Nc1ccc(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C11H14ClN3O5S/c1-21(19,20)14-5-4-13-11(18)15-7-2-3-8(10(16)17)9(12)6-7/h2-3,6,14H,4-5H2,1H3,(H,16,17)(H2,13,15,18) |
| InChIKey | IVANZQJFWQIHFX-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.77 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|