C11H14FN3O5S — CID 61202622
4-fluoro-2-[2-(methanesulfonamido)ethylcarbamoylamino]benzoic acid (PubChem CID 61202622) has the molecular formula C11H14FN3O5S and a molecular weight of 319.31 g/mol. Its IUPAC name is 4-fluoro-2-[2-(methanesulfonamido)ethylcarbamoylamino]benzoic acid.
| Compound Name | 4-fluoro-2-[2-(methanesulfonamido)ethylcarbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 61202622 |
| Molecular Formula | C11H14FN3O5S |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 4-fluoro-2-[2-(methanesulfonamido)ethylcarbamoylamino]benzoic acid |
| SMILES | CS(=O)(=O)NCCNC(=O)Nc1cc(F)ccc1C(=O)O |
| InChI | InChI=1S/C11H14FN3O5S/c1-21(19,20)14-5-4-13-11(18)15-9-6-7(12)2-3-8(9)10(16)17/h2-3,6,14H,4-5H2,1H3,(H,16,17)(H2,13,15,18) |
| InChIKey | RDTNSQGWXJWWTP-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|